C5H12FN — CID 123355722
1-fluoro-N,N-dimethylpropan-2-amine (PubChem CID 123355722) has the molecular formula C5H12FN and a molecular weight of 105.16 g/mol. Its IUPAC name is 1-fluoro-N,N-dimethylpropan-2-amine.
| Compound Name | 1-fluoro-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 123355722 |
| Molecular Formula | C5H12FN |
| Molecular Weight | 105.16 g/mol |
| Exact Mass | 105.10 |
| IUPAC Name | 1-fluoro-N,N-dimethylpropan-2-amine |
| SMILES | CC(CF)N(C)C |
| InChI | InChI=1S/C5H12FN/c1-5(4-6)7(2)3/h5H,4H2,1-3H3 |
| InChIKey | OIQKLDOHJFAVIQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 105.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |