C6H13F2N — CID 174323846
(2R)-4,4-difluoro-N,N-dimethylbutan-2-amine (PubChem CID 174323846) has the molecular formula C6H13F2N and a molecular weight of 137.17 g/mol. Its IUPAC name is (2R)-4,4-difluoro-N,N-dimethylbutan-2-amine.
| Compound Name | (2R)-4,4-difluoro-N,N-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 174323846 |
| Molecular Formula | C6H13F2N |
| Molecular Weight | 137.17 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | (2R)-4,4-difluoro-N,N-dimethylbutan-2-amine |
| SMILES | C[C@H](CC(F)F)N(C)C |
| InChI | InChI=1S/C6H13F2N/c1-5(9(2)3)4-6(7)8/h5-6H,4H2,1-3H3/t5-/m1/s1 |
| InChIKey | AMPIUBRCWSCZGB-RXMQYKEDSA-N |
| XLogP | 1.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |