C11H27N — CID 144654908
ethane;N,N,5-trimethylhexan-2-amine (PubChem CID 144654908) has the molecular formula C11H27N and a molecular weight of 173.34 g/mol. Its IUPAC name is ethane;N,N,5-trimethylhexan-2-amine.
| Compound Name | ethane;N,N,5-trimethylhexan-2-amine |
|---|---|
| PubChem CID | 144654908 |
| Molecular Formula | C11H27N |
| Molecular Weight | 173.34 g/mol |
| Exact Mass | 173.21 |
| IUPAC Name | ethane;N,N,5-trimethylhexan-2-amine |
| SMILES | CC.CC(C)CCC(C)N(C)C |
| InChI | InChI=1S/C9H21N.C2H6/c1-8(2)6-7-9(3)10(4)5;1-2/h8-9H,6-7H2,1-5H3;1-2H3 |
| InChIKey | VJTQQTHOTXBBOO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |