C17H38N2 — CID 87338569
6-N,6-N-dimethyl-1-N,1-N-bis(2-methylpropyl)heptane-1,6-diamine (PubChem CID 87338569) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is 6-N,6-N-dimethyl-1-N,1-N-bis(2-methylpropyl)heptane-1,6-diamine.
| Compound Name | 6-N,6-N-dimethyl-1-N,1-N-bis(2-methylpropyl)heptane-1,6-diamine |
|---|---|
| PubChem CID | 87338569 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 6-N,6-N-dimethyl-1-N,1-N-bis(2-methylpropyl)heptane-1,6-diamine |
| SMILES | CC(C)CN(CCCCCC(C)N(C)C)CC(C)C |
| InChI | InChI=1S/C17H38N2/c1-15(2)13-19(14-16(3)4)12-10-8-9-11-17(5)18(6)7/h15-17H,8-14H2,1-7H3 |
| InChIKey | QOMOIKOJUFLFGJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|