C13H31N — CID 145343513
but-1-ene;N,N-dimethylpentan-2-amine;ethane (PubChem CID 145343513) has the molecular formula C13H31N and a molecular weight of 201.40 g/mol. Its IUPAC name is but-1-ene;N,N-dimethylpentan-2-amine;ethane.
| Compound Name | but-1-ene;N,N-dimethylpentan-2-amine;ethane |
|---|---|
| PubChem CID | 145343513 |
| Molecular Formula | C13H31N |
| Molecular Weight | 201.40 g/mol |
| Exact Mass | 201.25 |
| IUPAC Name | but-1-ene;N,N-dimethylpentan-2-amine;ethane |
| SMILES | C=CCC.CC.CCCC(C)N(C)C |
| InChI | InChI=1S/C7H17N.C4H8.C2H6/c1-5-6-7(2)8(3)4;1-3-4-2;1-2/h7H,5-6H2,1-4H3;3H,1,4H2,2H3;1-2H3 |
| InChIKey | BIWKUFCWFLTZEA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|