C22H52N2Sn — CID 88628949
dibutyltin;bis(N,N-dimethylpentan-2-amine) (PubChem CID 88628949) has the molecular formula C22H52N2Sn and a molecular weight of 463.38 g/mol. Its IUPAC name is dibutyltin;bis(N,N-dimethylpentan-2-amine).
| Compound Name | dibutyltin;bis(N,N-dimethylpentan-2-amine) |
|---|---|
| PubChem CID | 88628949 |
| Molecular Formula | C22H52N2Sn |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | dibutyltin;bis(N,N-dimethylpentan-2-amine) |
| SMILES | CCCC(C)N(C)C.CCCC(C)N(C)C.CCCC[Sn]CCCC |
| InChI | InChI=1S/2C7H17N.2C4H9.Sn/c2*1-5-6-7(2)8(3)4;2*1-3-4-2;/h2*7H,5-6H2,1-4H3;2*1,3-4H2,2H3; |
| InChIKey | IKCZOQBDBMLMRQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|