About butyl(3,3-dimethoxypropyl)tin
butyl(3,3-dimethoxypropyl)tin (PubChem CID 87371389) has the molecular formula C9H20O2Sn
and a molecular weight of 278.97 g/mol. Its IUPAC name is butyl(3,3-dimethoxypropyl)tin.
Molecular Properties
| Compound Name | butyl(3,3-dimethoxypropyl)tin |
| PubChem CID | 87371389 |
| Molecular Formula | C9H20O2Sn |
| Molecular Weight | 278.97 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | butyl(3,3-dimethoxypropyl)tin |
| SMILES | CCCC[Sn]CCC(OC)OC |
| InChI | InChI=1S/C5H11O2.C4H9.Sn/c1-4-5(6-2)7-3;1-3-4-2;/h5H,1,4H2,2-3H3;1,3-4H2,2H3; |
| InChIKey | MDSLVLLXFXPULZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.97 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butyl(3,3-dimethoxypropyl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(3,3-dimethoxypropyl)tin?
The IUPAC name of butyl(3,3-dimethoxypropyl)tin (CID 87371389) is butyl(3,3-dimethoxypropyl)tin.
What is the SMILES notation for butyl(3,3-dimethoxypropyl)tin?
The canonical SMILES for butyl(3,3-dimethoxypropyl)tin is CCCC[Sn]CCC(OC)OC.
What is the InChIKey of butyl(3,3-dimethoxypropyl)tin?
The InChIKey is MDSLVLLXFXPULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O2.C4H9.Sn/c1-4-5(6-2)7-3;1-3-4-2;/h5H,1,4H2,2-3H3;1,3-4H2,2H3;.
What are the key properties of butyl(3,3-dimethoxypropyl)tin?
butyl(3,3-dimethoxypropyl)tin has a molecular weight of 278.97 g/mol, XLogP of 2.34, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(3,3-dimethoxypropyl)tin is sourced from PubChem (CID 87371389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).