About butyl(2,2-dimethoxyethyl)tin
butyl(2,2-dimethoxyethyl)tin (PubChem CID 87372194) has the molecular formula C8H18O2Sn
and a molecular weight of 264.94 g/mol. Its IUPAC name is butyl(2,2-dimethoxyethyl)tin.
Molecular Properties
| Compound Name | butyl(2,2-dimethoxyethyl)tin |
| PubChem CID | 87372194 |
| Molecular Formula | C8H18O2Sn |
| Molecular Weight | 264.94 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | butyl(2,2-dimethoxyethyl)tin |
| SMILES | CCCC[Sn]CC(OC)OC |
| InChI | InChI=1S/C4H9O2.C4H9.Sn/c1-4(5-2)6-3;1-3-4-2;/h4H,1H2,2-3H3;1,3-4H2,2H3; |
| InChIKey | PTMHRBJNYMMDLW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.94 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butyl(2,2-dimethoxyethyl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(2,2-dimethoxyethyl)tin?
The IUPAC name of butyl(2,2-dimethoxyethyl)tin (CID 87372194) is butyl(2,2-dimethoxyethyl)tin.
What is the SMILES notation for butyl(2,2-dimethoxyethyl)tin?
The canonical SMILES for butyl(2,2-dimethoxyethyl)tin is CCCC[Sn]CC(OC)OC.
What is the InChIKey of butyl(2,2-dimethoxyethyl)tin?
The InChIKey is PTMHRBJNYMMDLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O2.C4H9.Sn/c1-4(5-2)6-3;1-3-4-2;/h4H,1H2,2-3H3;1,3-4H2,2H3;.
What are the key properties of butyl(2,2-dimethoxyethyl)tin?
butyl(2,2-dimethoxyethyl)tin has a molecular weight of 264.94 g/mol, XLogP of 1.95, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(2,2-dimethoxyethyl)tin is sourced from PubChem (CID 87372194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).