About cyclohexyloxycyclohexane;dibutyltin
cyclohexyloxycyclohexane;dibutyltin (PubChem CID 87393205) has the molecular formula C20H40OSn
and a molecular weight of 415.25 g/mol. Its IUPAC name is cyclohexyloxycyclohexane;dibutyltin.
Molecular Properties
| Compound Name | cyclohexyloxycyclohexane;dibutyltin |
| PubChem CID | 87393205 |
| Molecular Formula | C20H40OSn |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | cyclohexyloxycyclohexane;dibutyltin |
| SMILES | C1CCC(OC2CCCCC2)CC1.CCCC[Sn]CCCC |
| InChI | InChI=1S/C12H22O.2C4H9.Sn/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2*1-3-4-2;/h11-12H,1-10H2;2*1,3-4H2,2H3; |
| InChIKey | INWMJEFPLQQVBS-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyloxycyclohexane;dibutyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyloxycyclohexane;dibutyltin?
The IUPAC name of cyclohexyloxycyclohexane;dibutyltin (CID 87393205) is cyclohexyloxycyclohexane;dibutyltin.
What is the SMILES notation for cyclohexyloxycyclohexane;dibutyltin?
The canonical SMILES for cyclohexyloxycyclohexane;dibutyltin is C1CCC(OC2CCCCC2)CC1.CCCC[Sn]CCCC.
What is the InChIKey of cyclohexyloxycyclohexane;dibutyltin?
The InChIKey is INWMJEFPLQQVBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O.2C4H9.Sn/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2*1-3-4-2;/h11-12H,1-10H2;2*1,3-4H2,2H3;.
What are the key properties of cyclohexyloxycyclohexane;dibutyltin?
cyclohexyloxycyclohexane;dibutyltin has a molecular weight of 415.25 g/mol, XLogP of 6.80, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyloxycyclohexane;dibutyltin is sourced from PubChem (CID 87393205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).