About butyl(methyl)tin;cyclohexyloxycyclohexane
butyl(methyl)tin;cyclohexyloxycyclohexane (PubChem CID 87393357) has the molecular formula C17H34OSn
and a molecular weight of 373.17 g/mol. Its IUPAC name is butyl(methyl)tin;cyclohexyloxycyclohexane.
Molecular Properties
| Compound Name | butyl(methyl)tin;cyclohexyloxycyclohexane |
| PubChem CID | 87393357 |
| Molecular Formula | C17H34OSn |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | butyl(methyl)tin;cyclohexyloxycyclohexane |
| SMILES | C1CCC(OC2CCCCC2)CC1.CCCC[Sn]C |
| InChI | InChI=1S/C12H22O.C4H9.CH3.Sn/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-4-2;;/h11-12H,1-10H2;1,3-4H2,2H3;1H3; |
| InChIKey | BSRGSGDXYVCCMH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl(methyl)tin;cyclohexyloxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(methyl)tin;cyclohexyloxycyclohexane?
The IUPAC name of butyl(methyl)tin;cyclohexyloxycyclohexane (CID 87393357) is butyl(methyl)tin;cyclohexyloxycyclohexane.
What is the SMILES notation for butyl(methyl)tin;cyclohexyloxycyclohexane?
The canonical SMILES for butyl(methyl)tin;cyclohexyloxycyclohexane is C1CCC(OC2CCCCC2)CC1.CCCC[Sn]C.
What is the InChIKey of butyl(methyl)tin;cyclohexyloxycyclohexane?
The InChIKey is BSRGSGDXYVCCMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O.C4H9.CH3.Sn/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-4-2;;/h11-12H,1-10H2;1,3-4H2,2H3;1H3;.
What are the key properties of butyl(methyl)tin;cyclohexyloxycyclohexane?
butyl(methyl)tin;cyclohexyloxycyclohexane has a molecular weight of 373.17 g/mol, XLogP of 5.63, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(methyl)tin;cyclohexyloxycyclohexane is sourced from PubChem (CID 87393357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).