About CID 173424592
CID 173424592 (PubChem CID 173424592) has the molecular formula C12H25BF3O
and a molecular weight of 253.14 g/mol.
Molecular Properties
| Compound Name | CID 173424592 |
| PubChem CID | 173424592 |
| Molecular Formula | C12H25BF3O |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | — |
| SMILES | C1CCC(OC2CCCCC2)CC1.F.F.F.[B] |
| InChI | InChI=1S/C12H22O.B.3FH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;;/h11-12H,1-10H2;;3*1H |
| InChIKey | PJYNFMQDJVDOEY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173424592 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173424592?
The IUPAC name of CID 173424592 (CID 173424592) is not available.
What is the SMILES notation for CID 173424592?
The canonical SMILES for CID 173424592 is C1CCC(OC2CCCCC2)CC1.F.F.F.[B].
What is the InChIKey of CID 173424592?
The InChIKey is PJYNFMQDJVDOEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O.B.3FH/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;;/h11-12H,1-10H2;;3*1H.
What are the key properties of CID 173424592?
CID 173424592 has a molecular weight of 253.14 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173424592 is sourced from PubChem (CID 173424592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).