About 2-cycloheptyloxyoxane
2-cycloheptyloxyoxane (PubChem CID 11735764) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-cycloheptyloxyoxane.
Molecular Properties
| Compound Name | 2-cycloheptyloxyoxane |
| PubChem CID | 11735764 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2-cycloheptyloxyoxane |
| SMILES | C1CCCC(OC2CCCCO2)CC1 |
| InChI | InChI=1S/C12H22O2/c1-2-4-8-11(7-3-1)14-12-9-5-6-10-13-12/h11-12H,1-10H2 |
| InChIKey | WTACSCGINFRHPI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cycloheptyloxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyloxyoxane?
The IUPAC name of 2-cycloheptyloxyoxane (CID 11735764) is 2-cycloheptyloxyoxane.
What is the SMILES notation for 2-cycloheptyloxyoxane?
The canonical SMILES for 2-cycloheptyloxyoxane is C1CCCC(OC2CCCCO2)CC1.
What is the InChIKey of 2-cycloheptyloxyoxane?
The InChIKey is WTACSCGINFRHPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-2-4-8-11(7-3-1)14-12-9-5-6-10-13-12/h11-12H,1-10H2.
What are the key properties of 2-cycloheptyloxyoxane?
2-cycloheptyloxyoxane has a molecular weight of 198.31 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyloxyoxane is sourced from PubChem (CID 11735764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).