C8H15NO2 — CID 86316698
cis-(1S,2R)-2-[(2S)-oxan-2-yl]oxycyclopropan-1-amine (PubChem CID 86316698) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is cis-(1S,2R)-2-[(2S)-oxan-2-yl]oxycyclopropan-1-amine.
| Compound Name | cis-(1S,2R)-2-[(2S)-oxan-2-yl]oxycyclopropan-1-amine |
|---|---|
| PubChem CID | 86316698 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | cis-(1S,2R)-2-[(2S)-oxan-2-yl]oxycyclopropan-1-amine |
| SMILES | N[C@H]1C[C@H]1O[C@H]1CCCCO1 |
| InChI | InChI=1S/C8H15NO2/c9-6-5-7(6)11-8-3-1-2-4-10-8/h6-8H,1-5,9H2/t6-,7+,8-/m0/s1 |
| InChIKey | JDCHTSRZCFQCAC-RNJXMRFFSA-N |
| XLogP | 0.63 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |