C12H16O2 — CID 131843933
2-(7-bicyclo[2.2.1]hepta-2,5-dienyloxy)oxane (PubChem CID 131843933) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-(7-bicyclo[2.2.1]hepta-2,5-dienyloxy)oxane.
| Compound Name | 2-(7-bicyclo[2.2.1]hepta-2,5-dienyloxy)oxane |
|---|---|
| PubChem CID | 131843933 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-(7-bicyclo[2.2.1]hepta-2,5-dienyloxy)oxane |
| SMILES | C1=CC2C=CC1C2OC1CCCCO1 |
| InChI | InChI=1S/C12H16O2/c1-2-8-13-11(3-1)14-12-9-4-5-10(12)7-6-9/h4-7,9-12H,1-3,8H2 |
| InChIKey | UYQZASQTXQNXEB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|