C10H16O3 — CID 10986966
(1S,4S)-4-(oxan-2-yloxy)cyclopent-2-en-1-ol (PubChem CID 10986966) has the molecular formula C10H16O3 and a molecular weight of 184.24 g/mol. Its IUPAC name is (1S,4S)-4-(oxan-2-yloxy)cyclopent-2-en-1-ol.
| Compound Name | (1S,4S)-4-(oxan-2-yloxy)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 10986966 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (1S,4S)-4-(oxan-2-yloxy)cyclopent-2-en-1-ol |
| SMILES | O[C@@H]1C=C[C@@H](OC2CCCCO2)C1 |
| InChI | InChI=1S/C10H16O3/c11-8-4-5-9(7-8)13-10-3-1-2-6-12-10/h4-5,8-11H,1-3,6-7H2/t8-,9-,10?/m1/s1 |
| InChIKey | RBQYRBFCQFHDHR-MGRQHWMJSA-N |
| XLogP | 1.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|