About 2-(oxetan-3-yloxy)oxane
2-(oxetan-3-yloxy)oxane (PubChem CID 54083112) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(oxetan-3-yloxy)oxane.
Molecular Properties
| Compound Name | 2-(oxetan-3-yloxy)oxane |
| PubChem CID | 54083112 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-(oxetan-3-yloxy)oxane |
| SMILES | C1CCC(OC2COC2)OC1 |
| InChI | InChI=1S/C8H14O3/c1-2-4-10-8(3-1)11-7-5-9-6-7/h7-8H,1-6H2 |
| InChIKey | MONHODFEBMCGNH-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(oxetan-3-yloxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxetan-3-yloxy)oxane?
The IUPAC name of 2-(oxetan-3-yloxy)oxane (CID 54083112) is 2-(oxetan-3-yloxy)oxane.
What is the SMILES notation for 2-(oxetan-3-yloxy)oxane?
The canonical SMILES for 2-(oxetan-3-yloxy)oxane is C1CCC(OC2COC2)OC1.
What is the InChIKey of 2-(oxetan-3-yloxy)oxane?
The InChIKey is MONHODFEBMCGNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-2-4-10-8(3-1)11-7-5-9-6-7/h7-8H,1-6H2.
What are the key properties of 2-(oxetan-3-yloxy)oxane?
2-(oxetan-3-yloxy)oxane has a molecular weight of 158.20 g/mol, XLogP of 0.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxetan-3-yloxy)oxane is sourced from PubChem (CID 54083112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).