C15H22O2 — CID 98518565
(2S)-2-[[(1S,6S)-8-tricyclo[4.3.1.01,6]dec-3-enyl]oxy]oxane (PubChem CID 98518565) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (2S)-2-[[(1S,6S)-8-tricyclo[4.3.1.01,6]dec-3-enyl]oxy]oxane.
| Compound Name | (2S)-2-[[(1S,6S)-8-tricyclo[4.3.1.01,6]dec-3-enyl]oxy]oxane |
|---|---|
| PubChem CID | 98518565 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2S)-2-[[(1S,6S)-8-tricyclo[4.3.1.01,6]dec-3-enyl]oxy]oxane |
| SMILES | C1=CC[C@]23CC(O[C@H]4CCCCO4)C[C@]2(C1)C3 |
| InChI | InChI=1S/C15H22O2/c1-4-8-16-13(5-1)17-12-9-14-6-2-3-7-15(14,10-12)11-14/h2-3,12-13H,1,4-11H2/t13-,14+,15+/m0/s1 |
| InChIKey | VUQBOEWMKVXUTQ-RRFJBIMHSA-N |
| XLogP | 3.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|