C11H19NO4 — CID 89143909
trans-(1R,3R)-2-imino-5-(oxan-2-yloxy)cyclohexane-1,3-diol (PubChem CID 89143909) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is trans-(1R,3R)-2-imino-5-(oxan-2-yloxy)cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3R)-2-imino-5-(oxan-2-yloxy)cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 89143909 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | trans-(1R,3R)-2-imino-5-(oxan-2-yloxy)cyclohexane-1,3-diol |
| SMILES | [H]N=C1[C@H](O)CC(OC2CCCCO2)C[C@H]1O |
| InChI | InChI=1S/C11H19NO4/c12-11-8(13)5-7(6-9(11)14)16-10-3-1-2-4-15-10/h7-10,12-14H,1-6H2/b12-11-/t7?,8-,9-,10?/m1/s1 |
| InChIKey | HSONSKBYFPJPBK-DKMMKKAJSA-N |
| XLogP | 0.43 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|