C11H18O5 — CID 59018729
(3S,3aS,6R,6aS)-6-(oxan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 59018729) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (3S,3aS,6R,6aS)-6-(oxan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3S,3aS,6R,6aS)-6-(oxan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 59018729 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (3S,3aS,6R,6aS)-6-(oxan-2-yloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@H]1CO[C@@H]2[C@H]1OC[C@H]2OC1CCCCO1 |
| InChI | InChI=1S/C11H18O5/c12-7-5-14-11-8(6-15-10(7)11)16-9-3-1-2-4-13-9/h7-12H,1-6H2/t7-,8+,9?,10-,11-/m0/s1 |
| InChIKey | CNBHBZZWRUQPTN-GDPLYGHDSA-N |
| XLogP | 0.06 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |