C11H20O3 — CID 98113125
[(1S,2S)-2-[(2R)-oxan-2-yl]oxycyclopentyl]methanol (PubChem CID 98113125) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is [(1S,2S)-2-[(2R)-oxan-2-yl]oxycyclopentyl]methanol.
| Compound Name | [(1S,2S)-2-[(2R)-oxan-2-yl]oxycyclopentyl]methanol |
|---|---|
| PubChem CID | 98113125 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | [(1S,2S)-2-[(2R)-oxan-2-yl]oxycyclopentyl]methanol |
| SMILES | OC[C@@H]1CCC[C@@H]1O[C@@H]1CCCCO1 |
| InChI | InChI=1S/C11H20O3/c12-8-9-4-3-5-10(9)14-11-6-1-2-7-13-11/h9-12H,1-8H2/t9-,10-,11+/m0/s1 |
| InChIKey | VGPZOQUMOOQFOH-GARJFASQSA-N |
| XLogP | 1.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |