C21H30O6S — CID 150396843
2-methyl-2-(4-methylsulfonylphenyl)-3-[2-(oxan-2-yloxy)cyclopentyl]propanoic acid (PubChem CID 150396843) has the molecular formula C21H30O6S and a molecular weight of 410.53 g/mol. Its IUPAC name is 2-methyl-2-(4-methylsulfonylphenyl)-3-[2-(oxan-2-yloxy)cyclopentyl]propanoic acid.
| Compound Name | 2-methyl-2-(4-methylsulfonylphenyl)-3-[2-(oxan-2-yloxy)cyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 150396843 |
| Molecular Formula | C21H30O6S |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-methyl-2-(4-methylsulfonylphenyl)-3-[2-(oxan-2-yloxy)cyclopentyl]propanoic acid |
| SMILES | CC(CC1CCCC1OC1CCCCO1)(C(=O)O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H30O6S/c1-21(20(22)23,16-9-11-17(12-10-16)28(2,24)25)14-15-6-5-7-18(15)27-19-8-3-4-13-26-19/h9-12,15,18-19H,3-8,13-14H2,1-2H3,(H,22,23) |
| InChIKey | HCXNXJVGEHJMIC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |