C14H20N2O5S — CID 94824413
4-(dimethylsulfamoyl)-N-[(2R)-oxan-2-yl]oxybenzamide (PubChem CID 94824413) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[(2R)-oxan-2-yl]oxybenzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[(2R)-oxan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 94824413 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[(2R)-oxan-2-yl]oxybenzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NO[C@@H]2CCCCO2)cc1 |
| InChI | InChI=1S/C14H20N2O5S/c1-16(2)22(18,19)12-8-6-11(7-9-12)14(17)15-21-13-5-3-4-10-20-13/h6-9,13H,3-5,10H2,1-2H3,(H,15,17)/t13-/m1/s1 |
| InChIKey | RPWFHTMYBADFKF-CYBMUJFWSA-N |
| XLogP | 1.12 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|