C14H18BrNO5 — CID 52829220
4-bromo-3,5-dimethoxy-N-[(2R)-oxan-2-yl]oxybenzamide (PubChem CID 52829220) has the molecular formula C14H18BrNO5 and a molecular weight of 360.20 g/mol. Its IUPAC name is 4-bromo-3,5-dimethoxy-N-[(2R)-oxan-2-yl]oxybenzamide.
| Compound Name | 4-bromo-3,5-dimethoxy-N-[(2R)-oxan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 52829220 |
| Molecular Formula | C14H18BrNO5 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 4-bromo-3,5-dimethoxy-N-[(2R)-oxan-2-yl]oxybenzamide |
| SMILES | COc1cc(C(=O)NO[C@@H]2CCCCO2)cc(OC)c1Br |
| InChI | InChI=1S/C14H18BrNO5/c1-18-10-7-9(8-11(19-2)13(10)15)14(17)16-21-12-5-3-4-6-20-12/h7-8,12H,3-6H2,1-2H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | UMYAIMKARBMJPA-GFCCVEGCSA-N |
| XLogP | 2.65 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|