C15H22BrClN2O3 — CID 119474386
N-(4-aminocyclohexyl)-4-bromo-3,5-dimethoxybenzamide;hydrochloride (PubChem CID 119474386) has the molecular formula C15H22BrClN2O3 and a molecular weight of 393.71 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-bromo-3,5-dimethoxybenzamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-4-bromo-3,5-dimethoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119474386 |
| Molecular Formula | C15H22BrClN2O3 |
| Molecular Weight | 393.71 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-bromo-3,5-dimethoxybenzamide;hydrochloride |
| SMILES | COc1cc(C(=O)NC2CCC(N)CC2)cc(OC)c1Br.Cl |
| InChI | InChI=1S/C15H21BrN2O3.ClH/c1-20-12-7-9(8-13(21-2)14(12)16)15(19)18-11-5-3-10(17)4-6-11;/h7-8,10-11H,3-6,17H2,1-2H3,(H,18,19);1H |
| InChIKey | VMMYPMYYHQSRLO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |