C18H32F2O3 — CID 173153155
4,4-difluoro-1-[2-(oxan-2-yloxy)cyclopentyl]octan-3-ol (PubChem CID 173153155) has the molecular formula C18H32F2O3 and a molecular weight of 334.45 g/mol. Its IUPAC name is 4,4-difluoro-1-[2-(oxan-2-yloxy)cyclopentyl]octan-3-ol.
| Compound Name | 4,4-difluoro-1-[2-(oxan-2-yloxy)cyclopentyl]octan-3-ol |
|---|---|
| PubChem CID | 173153155 |
| Molecular Formula | C18H32F2O3 |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 4,4-difluoro-1-[2-(oxan-2-yloxy)cyclopentyl]octan-3-ol |
| SMILES | CCCCC(F)(F)C(O)CCC1CCCC1OC1CCCCO1 |
| InChI | InChI=1S/C18H32F2O3/c1-2-3-12-18(19,20)16(21)11-10-14-7-6-8-15(14)23-17-9-4-5-13-22-17/h14-17,21H,2-13H2,1H3 |
| InChIKey | GKKDHBSLTNHIMS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |