C25H42F2O6 — CID 58601717
7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid (PubChem CID 58601717) has the molecular formula C25H42F2O6 and a molecular weight of 476.60 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 58601717 |
| Molecular Formula | C25H42F2O6 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
| SMILES | CCCCC(F)(F)C(=O)CC[C@@H]1[C@@H](CCCCCCC(=O)O)[C@@H](O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C25H42F2O6/c1-2-3-15-25(26,27)22(29)14-13-19-18(10-6-4-5-7-11-23(30)31)20(28)17-21(19)33-24-12-8-9-16-32-24/h18-21,24,28H,2-17H2,1H3,(H,30,31)/t18-,19-,20+,21-,24?/m1/s1 |
| InChIKey | CVNJBNJPFPBEIG-HNHYWVBESA-N |
| XLogP | 5.50 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|