C31H60O6Si — CID 18636952
7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid (PubChem CID 18636952) has the molecular formula C31H60O6Si and a molecular weight of 556.90 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18636952 |
| Molecular Formula | C31H60O6Si |
| Molecular Weight | 556.90 g/mol |
| Exact Mass | 556.42 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxyoctyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]heptanoic acid |
| SMILES | CCCCC[C@@H](CC[C@H]1C(OC2CCCCO2)C[C@H](O)[C@@H]1CCCCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H60O6Si/c1-7-8-11-16-24(37-38(5,6)31(2,3)4)20-21-26-25(17-12-9-10-13-18-29(33)34)27(32)23-28(26)36-30-19-14-15-22-35-30/h24-28,30,32H,7-23H2,1-6H3,(H,33,34)/t24-,25+,26+,27-,28?,30?/m0/s1 |
| InChIKey | RVHPXTSTRHDSNS-WUFMYJHXSA-N |
| XLogP | 8.07 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.90 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|