C44H66O7Si — CID 18636811
7-[(1R,2R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylpropyl]-3-(oxan-2-yloxy)-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid (PubChem CID 18636811) has the molecular formula C44H66O7Si and a molecular weight of 735.09 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylpropyl]-3-(oxan-2-yloxy)-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylpropyl]-3-(oxan-2-yloxy)-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18636811 |
| Molecular Formula | C44H66O7Si |
| Molecular Weight | 735.09 g/mol |
| Exact Mass | 734.46 |
| IUPAC Name | 7-[(1R,2R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclopentylpropyl]-3-(oxan-2-yloxy)-5-(4-phenylbenzoyl)oxycyclopentyl]heptanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CC[C@H]1C(OC2CCCCO2)C[C@H](OC(=O)c2ccc(-c3ccccc3)cc2)[C@@H]1CCCCCCC(=O)O)C1CCCC1 |
| InChI | InChI=1S/C44H66O7Si/c1-44(2,3)52(4,5)51-38(34-19-13-14-20-34)29-28-37-36(21-11-6-7-12-22-41(45)46)40(31-39(37)49-42-23-15-16-30-48-42)50-43(47)35-26-24-33(25-27-35)32-17-9-8-10-18-32/h8-10,17-18,24-27,34,36-40,42H,6-7,11-16,19-23,28-31H2,1-5H3,(H,45,46)/t36-,37-,38?,39?,40+,42?/m1/s1 |
| InChIKey | HNDQXVWMOJXTMO-RDDUIHAASA-N |
| XLogP | 11.21 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.09 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|