C25H38O6 — CID 121447711
7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-5-(oxan-2-yloxy)-3-phenylmethoxycyclopentyl]heptanoic acid (PubChem CID 121447711) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-5-(oxan-2-yloxy)-3-phenylmethoxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-5-(oxan-2-yloxy)-3-phenylmethoxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 121447711 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-5-(oxan-2-yloxy)-3-phenylmethoxycyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@@H]1[C@@H](CO)[C@H](OCc2ccccc2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C25H38O6/c26-17-21-20(12-6-1-2-7-13-24(27)28)23(31-25-14-8-9-15-29-25)16-22(21)30-18-19-10-4-3-5-11-19/h3-5,10-11,20-23,25-26H,1-2,6-9,12-18H2,(H,27,28)/t20-,21-,22-,23+,25?/m1/s1 |
| InChIKey | XAHIIGGBJJXKAK-GGDOJKPSSA-N |
| XLogP | 4.54 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|