C34H45NO6 — CID 70374255
(Z)-7-[(1R,2R,3S,5S)-2-morpholin-4-yl-3-(oxan-2-yloxy)-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoic acid (PubChem CID 70374255) has the molecular formula C34H45NO6 and a molecular weight of 563.74 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,5S)-2-morpholin-4-yl-3-(oxan-2-yloxy)-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,5S)-2-morpholin-4-yl-3-(oxan-2-yloxy)-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 70374255 |
| Molecular Formula | C34H45NO6 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,5S)-2-morpholin-4-yl-3-(oxan-2-yloxy)-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoic acid |
| SMILES | O=C(O)CC/C=C\CC[C@@H]1[C@@H](N2CCOCC2)[C@@H](OC2CCCCO2)C[C@@H]1OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H45NO6/c36-32(37)13-7-2-1-6-12-29-30(40-25-26-15-17-28(18-16-26)27-10-4-3-5-11-27)24-31(41-33-14-8-9-21-39-33)34(29)35-19-22-38-23-20-35/h1-5,10-11,15-18,29-31,33-34H,6-9,12-14,19-25H2,(H,36,37)/b2-1-/t29-,30-,31-,33?,34+/m0/s1 |
| InChIKey | YTZUWDIIYXSLHK-GTZGFJEASA-N |
| XLogP | 6.07 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|