C24H35NO6 — CID 70548536
(Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2-morpholin-4-ylcyclopentyl]hept-4-enoic acid (PubChem CID 70548536) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2-morpholin-4-ylcyclopentyl]hept-4-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2-morpholin-4-ylcyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 70548536 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-5-[(4-methoxyphenyl)methoxy]-2-morpholin-4-ylcyclopentyl]hept-4-enoic acid |
| SMILES | COc1ccc(CO[C@H]2C[C@@H](O)[C@H](N3CCOCC3)[C@H]2CC/C=C\CCC(=O)O)cc1 |
| InChI | InChI=1S/C24H35NO6/c1-29-19-10-8-18(9-11-19)17-31-22-16-21(26)24(25-12-14-30-15-13-25)20(22)6-4-2-3-5-7-23(27)28/h2-3,8-11,20-22,24,26H,4-7,12-17H2,1H3,(H,27,28)/b3-2-/t20-,21+,22-,24+/m0/s1 |
| InChIKey | PRKBTFWNWSEOJU-FZFFFKPESA-N |
| XLogP | 2.86 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|