C24H36BNO6 — CID 70374496
(Z)-7-[(1R,2R,3S,5S)-5-[(4-boronophenyl)methoxy]-3-hydroxy-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid (PubChem CID 70374496) has the molecular formula C24H36BNO6 and a molecular weight of 445.37 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,5S)-5-[(4-boronophenyl)methoxy]-3-hydroxy-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,5S)-5-[(4-boronophenyl)methoxy]-3-hydroxy-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 70374496 |
| Molecular Formula | C24H36BNO6 |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,5S)-5-[(4-boronophenyl)methoxy]-3-hydroxy-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid |
| SMILES | O=C(O)CC/C=C\CC[C@@H]1[C@@H](N2CCCCC2)[C@@H](O)C[C@@H]1OCc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C24H36BNO6/c27-21-16-22(32-17-18-10-12-19(13-11-18)25(30)31)20(8-4-1-2-5-9-23(28)29)24(21)26-14-6-3-7-15-26/h1-2,10-13,20-22,24,27,30-31H,3-9,14-17H2,(H,28,29)/b2-1-/t20-,21-,22-,24+/m0/s1 |
| InChIKey | IFADFSXAYOOMQG-NJHHWIOXSA-N |
| XLogP | 1.69 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|