C24H34N4O4 — CID 54527128
7-[(1R,2R,3R,5S)-5-[(4-azidophenyl)methoxy]-3-hydroxy-2-piperidin-1-ylcyclopentyl]hept-5-enoic acid (PubChem CID 54527128) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-5-[(4-azidophenyl)methoxy]-3-hydroxy-2-piperidin-1-ylcyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-5-[(4-azidophenyl)methoxy]-3-hydroxy-2-piperidin-1-ylcyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54527128 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-5-[(4-azidophenyl)methoxy]-3-hydroxy-2-piperidin-1-ylcyclopentyl]hept-5-enoic acid |
| SMILES | [N-]=[N+]=Nc1ccc(CO[C@H]2C[C@@H](O)[C@H](N3CCCCC3)[C@H]2CC=CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C24H34N4O4/c25-27-26-19-12-10-18(11-13-19)17-32-22-16-21(29)24(28-14-6-3-7-15-28)20(22)8-4-1-2-5-9-23(30)31/h1,4,10-13,20-22,24,29H,2-3,5-9,14-17H2,(H,30,31)/t20-,21+,22-,24+/m0/s1 |
| InChIKey | YTXKCXPVEHQULZ-HYVLGVRCSA-N |
| XLogP | 4.95 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|