C31H43NO4 — CID 70510147
(Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-[methyl(5-phenylpentyl)amino]-5-phenylmethoxycyclopentyl]hept-5-enoic acid (PubChem CID 70510147) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-[methyl(5-phenylpentyl)amino]-5-phenylmethoxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-[methyl(5-phenylpentyl)amino]-5-phenylmethoxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70510147 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3-hydroxy-2-[methyl(5-phenylpentyl)amino]-5-phenylmethoxycyclopentyl]hept-5-enoic acid |
| SMILES | CN(CCCCCc1ccccc1)[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](OCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C31H43NO4/c1-32(22-14-6-11-17-25-15-7-4-8-16-25)31-27(20-12-2-3-13-21-30(34)35)29(23-28(31)33)36-24-26-18-9-5-10-19-26/h2,4-5,7-10,12,15-16,18-19,27-29,31,33H,3,6,11,13-14,17,20-24H2,1H3,(H,34,35)/b12-2-/t27-,28+,29-,31+/m0/s1 |
| InChIKey | SXYSZILOZSKUNX-RBGTUXFYSA-N |
| XLogP | 5.87 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|