C23H34O3 — CID 142078244
(Z)-7-[(1R,2R,3R)-3-hydroxy-2-(5-phenylpentyl)cyclopentyl]hept-5-enoic acid (PubChem CID 142078244) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-3-hydroxy-2-(5-phenylpentyl)cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-3-hydroxy-2-(5-phenylpentyl)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 142078244 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-3-hydroxy-2-(5-phenylpentyl)cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1CC[C@@H](O)[C@@H]1CCCCCc1ccccc1 |
| InChI | InChI=1S/C23H34O3/c24-22-18-17-20(14-8-1-2-10-16-23(25)26)21(22)15-9-4-7-13-19-11-5-3-6-12-19/h1,3,5-6,8,11-12,20-22,24H,2,4,7,9-10,13-18H2,(H,25,26)/b8-1-/t20-,21+,22+/m0/s1 |
| InChIKey | XIHIKTPWKBDTRU-KRHJVALNSA-N |
| XLogP | 5.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|