C23H33ClO4 — CID 91163530
7-[(1R,2R,3R)-2-[(3R)-5-(3-chlorophenyl)-3-hydroxypentyl]-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 91163530) has the molecular formula C23H33ClO4 and a molecular weight of 408.97 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[(3R)-5-(3-chlorophenyl)-3-hydroxypentyl]-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[(3R)-5-(3-chlorophenyl)-3-hydroxypentyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91163530 |
| Molecular Formula | C23H33ClO4 |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[(3R)-5-(3-chlorophenyl)-3-hydroxypentyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1CC[C@@H](O)[C@@H]1CC[C@@H](O)CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H33ClO4/c24-19-8-5-6-17(16-19)10-12-20(25)13-14-21-18(11-15-22(21)26)7-3-1-2-4-9-23(27)28/h1,3,5-6,8,16,18,20-22,25-26H,2,4,7,9-15H2,(H,27,28)/t18-,20-,21+,22+/m0/s1 |
| InChIKey | DEAAMJQYFUXYAE-VXSCBNMQSA-N |
| XLogP | 5.00 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|