C23H31F3O6 — CID 20655966
(E)-7-[3,5-dihydroxy-2-[2-hydroxy-4-[3-(trifluoromethyl)phenyl]butoxy]cyclopentyl]hept-5-enoic acid (PubChem CID 20655966) has the molecular formula C23H31F3O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is (E)-7-[3,5-dihydroxy-2-[2-hydroxy-4-[3-(trifluoromethyl)phenyl]butoxy]cyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[3,5-dihydroxy-2-[2-hydroxy-4-[3-(trifluoromethyl)phenyl]butoxy]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 20655966 |
| Molecular Formula | C23H31F3O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (E)-7-[3,5-dihydroxy-2-[2-hydroxy-4-[3-(trifluoromethyl)phenyl]butoxy]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CC1C(O)CC(O)C1OCC(O)CCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H31F3O6/c24-23(25,26)16-7-5-6-15(12-16)10-11-17(27)14-32-22-18(19(28)13-20(22)29)8-3-1-2-4-9-21(30)31/h1,3,5-7,12,17-20,22,27-29H,2,4,8-11,13-14H2,(H,30,31)/b3-1+ |
| InChIKey | XLSNJVCYRKKOFS-HNQUOIGGSA-N |
| XLogP | 3.33 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|