C23H29F3O6 — CID 123389055
7-[3,5-dihydroxy-2-[3-oxo-4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoic acid (PubChem CID 123389055) has the molecular formula C23H29F3O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is 7-[3,5-dihydroxy-2-[3-oxo-4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[3,5-dihydroxy-2-[3-oxo-4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 123389055 |
| Molecular Formula | C23H29F3O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 7-[3,5-dihydroxy-2-[3-oxo-4-[3-(trifluoromethyl)phenoxy]butyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CCC1C(O)CC(O)C1CCC(=O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H29F3O6/c24-23(25,26)15-6-5-7-17(12-15)32-14-16(27)10-11-19-18(20(28)13-21(19)29)8-3-1-2-4-9-22(30)31/h1,3,5-7,12,18-21,28-29H,2,4,8-11,13-14H2,(H,30,31) |
| InChIKey | VCNWURRLSPRXEI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|