C23H27F3O5 — CID 142858566
(Z)-7-[(1S,3R,4S,5S)-3-[(E)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid (PubChem CID 142858566) has the molecular formula C23H27F3O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is (Z)-7-[(1S,3R,4S,5S)-3-[(E)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,3R,4S,5S)-3-[(E)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 142858566 |
| Molecular Formula | C23H27F3O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (Z)-7-[(1S,3R,4S,5S)-3-[(E)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@@H]2C[C@@H](O2)O[C@@H]1/C=C/CCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H27F3O5/c24-23(25,26)16-8-7-9-17(14-16)29-13-6-5-11-19-18(20-15-22(30-19)31-20)10-3-1-2-4-12-21(27)28/h1,3,5,7-9,11,14,18-20,22H,2,4,6,10,12-13,15H2,(H,27,28)/b3-1-,11-5+/t18-,19-,20+,22-/m1/s1 |
| InChIKey | LXCRNCVHBSQWQP-LRRQJCDGSA-N |
| XLogP | 5.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|