C23H30O4 — CID 142858559
(Z)-7-[(1S,3R,4S,5S)-3-[(E)-5-phenylpent-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid (PubChem CID 142858559) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (Z)-7-[(1S,3R,4S,5S)-3-[(E)-5-phenylpent-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,3R,4S,5S)-3-[(E)-5-phenylpent-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 142858559 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (Z)-7-[(1S,3R,4S,5S)-3-[(E)-5-phenylpent-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@@H]2C[C@@H](O2)O[C@@H]1/C=C/CCCc1ccccc1 |
| InChI | InChI=1S/C23H30O4/c24-22(25)16-10-2-1-8-14-19-20(26-23-17-21(19)27-23)15-9-4-7-13-18-11-5-3-6-12-18/h1,3,5-6,8-9,11-12,15,19-21,23H,2,4,7,10,13-14,16-17H2,(H,24,25)/b8-1-,15-9+/t19-,20-,21+,23-/m1/s1 |
| InChIKey | RIWRFMLOXAZCGM-SBOQRPOBSA-N |
| XLogP | 4.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|