C23H30O4 — CID 10177191
(E)-7-[(1R,3R)-3-hydroxy-5-oxo-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 10177191) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (E)-7-[(1R,3R)-3-hydroxy-5-oxo-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[(1R,3R)-3-hydroxy-5-oxo-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10177191 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (E)-7-[(1R,3R)-3-hydroxy-5-oxo-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/C[C@H]1C(=O)C[C@@H](O)C1/C=C/CCCc1ccccc1 |
| InChI | InChI=1S/C23H30O4/c24-21-17-22(25)20(19(21)14-8-1-2-10-16-23(26)27)15-9-4-7-13-18-11-5-3-6-12-18/h1,3,5-6,8-9,11-12,15,19-20,22,25H,2,4,7,10,13-14,16-17H2,(H,26,27)/b8-1+,15-9+/t19-,20?,22-/m1/s1 |
| InChIKey | XGKXHQFRLKVBKA-RBFSJQQSSA-N |
| XLogP | 4.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|