C27H32O5 — CID 10181497
(Z)-7-[(1R,2R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 10181497) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is (Z)-7-[(1R,2R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10181497 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (Z)-7-[(1R,2R)-3-hydroxy-2-[(E,3S)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1C(=O)CC(O)[C@@H]1/C=C/[C@@H](O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H32O5/c28-22(14-12-19-11-13-20-7-5-6-8-21(20)17-19)15-16-24-23(25(29)18-26(24)30)9-3-1-2-4-10-27(31)32/h1,3,5-8,11,13,15-17,22-24,26,28,30H,2,4,9-10,12,14,18H2,(H,31,32)/b3-1-,16-15+/t22-,23+,24+,26?/m0/s1 |
| InChIKey | DIVLHKGWGUMUFX-NMKLXOIPSA-N |
| XLogP | 4.46 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|