C29H36O4 — CID 143312312
(Z)-7-[(1R,5R)-5-[(E)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoic acid (PubChem CID 143312312) has the molecular formula C29H36O4 and a molecular weight of 448.60 g/mol. Its IUPAC name is (Z)-7-[(1R,5R)-5-[(E)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,5R)-5-[(E)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 143312312 |
| Molecular Formula | C29H36O4 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (Z)-7-[(1R,5R)-5-[(E)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CC1(C)C[C@H](/C=C/C(O)CCc2ccc3ccccc3c2)[C@@H](C/C=C\CCCC(=O)O)C1=O |
| InChI | InChI=1S/C29H36O4/c1-29(2)20-24(26(28(29)33)11-5-3-4-6-12-27(31)32)16-18-25(30)17-14-21-13-15-22-9-7-8-10-23(22)19-21/h3,5,7-10,13,15-16,18-19,24-26,30H,4,6,11-12,14,17,20H2,1-2H3,(H,31,32)/b5-3-,18-16+/t24-,25?,26+/m0/s1 |
| InChIKey | TYYDFAIDYVLROA-CCYRKGHGSA-N |
| XLogP | 6.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|