C24H33BrO4 — CID 91175606
7-[(1R,2R)-2-[(3S)-5-(4-bromo-3-methylphenyl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 91175606) has the molecular formula C24H33BrO4 and a molecular weight of 465.43 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(3S)-5-(4-bromo-3-methylphenyl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[(3S)-5-(4-bromo-3-methylphenyl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91175606 |
| Molecular Formula | C24H33BrO4 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 7-[(1R,2R)-2-[(3S)-5-(4-bromo-3-methylphenyl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | Cc1cc(CC[C@H](O)C=C[C@H]2CCC(O)[C@@H]2CC=CCCCC(=O)O)ccc1Br |
| InChI | InChI=1S/C24H33BrO4/c1-17-16-18(9-14-22(17)25)8-12-20(26)13-10-19-11-15-23(27)21(19)6-4-2-3-5-7-24(28)29/h2,4,9-10,13-14,16,19-21,23,26-27H,3,5-8,11-12,15H2,1H3,(H,28,29)/t19-,20-,21+,23?/m0/s1 |
| InChIKey | YHAAORWCBMISDR-ZDIDWYTNSA-N |
| XLogP | 5.20 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|