C20H34O4 — CID 57008385
7-[(1R,2S,5R)-2-hydroxy-5-(3-hydroxy-4-methylhept-1-enyl)cyclopentyl]hept-5-enoic acid (PubChem CID 57008385) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 7-[(1R,2S,5R)-2-hydroxy-5-(3-hydroxy-4-methylhept-1-enyl)cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,5R)-2-hydroxy-5-(3-hydroxy-4-methylhept-1-enyl)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57008385 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 7-[(1R,2S,5R)-2-hydroxy-5-(3-hydroxy-4-methylhept-1-enyl)cyclopentyl]hept-5-enoic acid |
| SMILES | CCCC(C)C(O)C=C[C@H]1CC[C@H](O)[C@@H]1CC=CCCCC(=O)O |
| InChI | InChI=1S/C20H34O4/c1-3-8-15(2)18(21)13-11-16-12-14-19(22)17(16)9-6-4-5-7-10-20(23)24/h4,6,11,13,15-19,21-22H,3,5,7-10,12,14H2,1-2H3,(H,23,24)/t15?,16-,17+,18?,19-/m0/s1 |
| InChIKey | HKZIPRBVKHVVSG-BPJBSSMVSA-N |
| XLogP | 3.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|