C24H35BrO4S — CID 91147126
7-[(1R,2R)-2-[(3S)-5-(4-bromo-3-ethyl-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 91147126) has the molecular formula C24H35BrO4S and a molecular weight of 499.51 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(3S)-5-(4-bromo-3-ethyl-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[(3S)-5-(4-bromo-3-ethyl-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91147126 |
| Molecular Formula | C24H35BrO4S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 7-[(1R,2R)-2-[(3S)-5-(4-bromo-3-ethyl-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CCc1c(CC[C@H](O)C=C[C@H]2CCC(O)[C@@H]2CC=CCCCC(=O)O)sc(C)c1Br |
| InChI | InChI=1S/C24H35BrO4S/c1-3-19-22(30-16(2)24(19)25)15-13-18(26)12-10-17-11-14-21(27)20(17)8-6-4-5-7-9-23(28)29/h4,6,10,12,17-18,20-21,26-27H,3,5,7-9,11,13-15H2,1-2H3,(H,28,29)/t17-,18+,20+,21?/m0/s1 |
| InChIKey | ASZUAVZHVNCXEK-ICWHHGQHSA-N |
| XLogP | 5.82 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|