C21H27BrO4S — CID 58806910
(Z)-7-[(1R,2R)-2-[(E)-4-(4-bromo-5-methylthiophen-2-yl)-3-oxobut-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 58806910) has the molecular formula C21H27BrO4S and a molecular weight of 455.41 g/mol. Its IUPAC name is (Z)-7-[(1R,2R)-2-[(E)-4-(4-bromo-5-methylthiophen-2-yl)-3-oxobut-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R)-2-[(E)-4-(4-bromo-5-methylthiophen-2-yl)-3-oxobut-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 58806910 |
| Molecular Formula | C21H27BrO4S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | (Z)-7-[(1R,2R)-2-[(E)-4-(4-bromo-5-methylthiophen-2-yl)-3-oxobut-1-enyl]-5-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | Cc1sc(CC(=O)/C=C/[C@H]2CCC(O)[C@@H]2C/C=C\CCCC(=O)O)cc1Br |
| InChI | InChI=1S/C21H27BrO4S/c1-14-19(22)13-17(27-14)12-16(23)10-8-15-9-11-20(24)18(15)6-4-2-3-5-7-21(25)26/h2,4,8,10,13,15,18,20,24H,3,5-7,9,11-12H2,1H3,(H,25,26)/b4-2-,10-8+/t15-,18+,20?/m0/s1 |
| InChIKey | POMQNJUBMFCXJZ-OMNATEPASA-N |
| XLogP | 5.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|