C23H33BrO3S — CID 90977423
8-[(2R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]oct-6-en-2-one (PubChem CID 90977423) has the molecular formula C23H33BrO3S and a molecular weight of 469.49 g/mol. Its IUPAC name is 8-[(2R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]oct-6-en-2-one.
| Compound Name | 8-[(2R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]oct-6-en-2-one |
|---|---|
| PubChem CID | 90977423 |
| Molecular Formula | C23H33BrO3S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 8-[(2R)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-5-hydroxycyclopentyl]oct-6-en-2-one |
| SMILES | CC(=O)CCCC=CCC1C(O)CC[C@@H]1C=C[C@@H](O)CCc1cc(Br)c(C)s1 |
| InChI | InChI=1S/C23H33BrO3S/c1-16(25)7-5-3-4-6-8-21-18(10-14-23(21)27)9-11-19(26)12-13-20-15-22(24)17(2)28-20/h4,6,9,11,15,18-19,21,23,26-27H,3,5,7-8,10,12-14H2,1-2H3/t18-,19+,21?,23?/m0/s1 |
| InChIKey | WBUQHYRHVHNXSG-BYUXKFDVSA-N |
| XLogP | 5.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|