C24H36BrNO6S2 — CID 91511994
7-[(1R,2R,3R,5S)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]-N-ethylsulfonylhept-5-enamide (PubChem CID 91511994) has the molecular formula C24H36BrNO6S2 and a molecular weight of 578.59 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]-N-ethylsulfonylhept-5-enamide.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]-N-ethylsulfonylhept-5-enamide |
|---|---|
| PubChem CID | 91511994 |
| Molecular Formula | C24H36BrNO6S2 |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3,5-dihydroxycyclopentyl]-N-ethylsulfonylhept-5-enamide |
| SMILES | CCS(=O)(=O)NC(=O)CCCC=CC[C@@H]1[C@@H](C=C[C@@H](O)CCc2cc(Br)c(C)s2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C24H36BrNO6S2/c1-3-34(31,32)26-24(30)9-7-5-4-6-8-19-20(23(29)15-22(19)28)13-11-17(27)10-12-18-14-21(25)16(2)33-18/h4,6,11,13-14,17,19-20,22-23,27-29H,3,5,7-10,12,15H2,1-2H3,(H,26,30)/t17-,19+,20+,22-,23+/m0/s1 |
| InChIKey | FPSODEQEHLFRBM-XXEXIIQFSA-N |
| XLogP | 3.61 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|