C24H34BrNO3S — CID 11533332
(Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]hept-5-enamide (PubChem CID 11533332) has the molecular formula C24H34BrNO3S and a molecular weight of 496.51 g/mol. Its IUPAC name is (Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]hept-5-enamide.
| Compound Name | (Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]hept-5-enamide |
|---|---|
| PubChem CID | 11533332 |
| Molecular Formula | C24H34BrNO3S |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | (Z)-7-[(1R,2S)-2-[(E,3S)-5-(4-bromo-5-methylthiophen-2-yl)-3-hydroxypent-1-enyl]-3-ethenyl-5-hydroxycyclopentyl]hept-5-enamide |
| SMILES | C=CC1CC(O)[C@H](C/C=C\CCCC(N)=O)[C@H]1/C=C/[C@@H](O)CCc1cc(Br)c(C)s1 |
| InChI | InChI=1S/C24H34BrNO3S/c1-3-17-14-23(28)21(8-6-4-5-7-9-24(26)29)20(17)13-11-18(27)10-12-19-15-22(25)16(2)30-19/h3-4,6,11,13,15,17-18,20-21,23,27-28H,1,5,7-10,12,14H2,2H3,(H2,26,29)/b6-4-,13-11+/t17?,18-,20-,21+,23?/m0/s1 |
| InChIKey | QYUJINVRLMPICO-VJLZDVSSSA-N |
| XLogP | 5.07 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|